Introduction：Basic information about CAS 111821-49-9|4-Borono-D-phenylalanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Borono-D-phenylalanine |
|---|
| CAS Number | 111821-49-9 | Molecular Weight | 209.007 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 449.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H12BNO4 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 225.5±31.5 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-borono-d-phenylalanine b10 enriched |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 449.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H12BNO4 |
|---|
| Molecular Weight | 209.007 |
|---|
| Flash Point | 225.5±31.5 °C |
|---|
| Exact Mass | 209.085938 |
|---|
| PSA | 103.78000 |
|---|
| LogP | 0.49 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | NFIVJOSXJDORSP-MRVPVSSYSA-N |
|---|
| SMILES | NC(Cc1ccc(B(O)O)cc1)C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S37/39-S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| RTECS | AY4240000 |
|---|
Synonyms
| (R)-2-Amino-3-(4-boronophenyl)propanoic acid |
| Benzeneboronic acid, p-(2-amino-2-carboxyethyl)- |
| UNII:UID84303EL |
| D-Phenylalanine, 4-borono- |
| 4-(dihydroxyboranyl)phenylalanine |
| 3-(p-Boronophenyl)alanine |
| MFCD03452760 |
| (2R)-2-amino-3-(4-boronophenyl)propanoic acid |
| Alanine, 3-(p-boronophenyl)- |
| Phenylalanine, 4-borono- |
| 4-(Dihydroxyboryl)-D-phenylalanine |
| 4-Borono-D-phenylalanine |
| 4-BORONO-PHENYLALANINE |
| 2-amino-3-[4-(dihydroxyboryl)phenyl]propanoic acid |
| p-(2-Amino-2-carboxyethyl)benzeneboronic acid |
| 4-(Dihydroxyboryl)phenylalanine |
| 4-dihydroxyborylphenylalanine |
| para-Boronophenylalanine |
