Introduction:Basic information about CAS 19370-34-4|1-SEC-BUTYL-2-NITROBENZENE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-SEC-BUTYL-2-NITROBENZENE |
|---|
| CAS Number | 19370-34-4 | Molecular Weight | 179.21600 |
|---|
| Density | 1.067g/cm3 | Boiling Point | 273.2ºC at 760mmHg |
|---|
| Molecular Formula | C10H13NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 114.7ºC |
|---|
Names
| Name | 1-butan-2-yl-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.067g/cm3 |
|---|
| Boiling Point | 273.2ºC at 760mmHg |
|---|
| Molecular Formula | C10H13NO2 |
|---|
| Molecular Weight | 179.21600 |
|---|
| Flash Point | 114.7ºC |
|---|
| Exact Mass | 179.09500 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.63150 |
|---|
| Vapour Pressure | 0.0097mmHg at 25°C |
|---|
| Index of Refraction | 1.527 |
|---|
| InChIKey | GMQQDASXGTUDPJ-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)c1ccccc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2904209090 |
|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| ortho-Nitrophenyl-2-butan |
| 2-Nitro-s-butylbenzol |
| EINECS 242-998-2 |
| 1-sec-Butyl-2-nitrobenzene |
| 1-(sec-Butyl)-2-nitrobenzene |
| 1-sec-Butyl-2-nitro-benzol |