Introduction:Basic information about CAS 2043-47-2|3,3,4,4,5,5,6,6,6-Nonafluoro-1-hexanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3,4,4,5,5,6,6,6-Nonafluoro-1-hexanol |
|---|
| CAS Number | 2043-47-2 | Molecular Weight | 264.089 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 109.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H5F9O | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 20.1±27.3 °C |
|---|
Names
| Name | 3,3,4,4,5,5,6,6,6-nonafluorohexan-1-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 109.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H5F9O |
|---|
| Molecular Weight | 264.089 |
|---|
| Flash Point | 20.1±27.3 °C |
|---|
| Exact Mass | 264.019684 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 2.38 |
|---|
| Vapour Pressure | 12.9±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.301 |
|---|
| InChIKey | JCMNMOBHVPONLD-UHFFFAOYSA-N |
|---|
| SMILES | OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| RIDADR | NA 1993 / PGIII |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2905590090 |
|---|
Customs
| HS Code | 2905590090 |
|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1H,1H,2H,2H-Perfluorohexan-1-ol |
| 3,3,4,4,5,5,6,6,6-nonafluorohexanol |
| 3,3,4,4,5,5,6,6,6-Nonafluoro-1-hexanol |
| 2-(Perfluorobutyl)ethanol |
| 1h,1h,2h,2h-nonafluorohexan-1-ol |
| 3,3,4,4,5,5,6,6,6-Nonafluorohexan-1-ol |
| MFCD00039543 |
| 6,6,6,5,5,4,4,3,3-nonafluorohexan-1-ol |
| 1H,1H,2H,2H-Nonafluoro-1-hexanol |
| 1-Hexanol, 3,3,4,4,5,5,6,6,6-nonafluoro- |
| 2-(perfluoro-n-butyl)ethanol |
| EINECS 218-050-9 |
| 1H,1H,2H,2H-Perfluorohexanol |