Introduction:Basic information about CAS 19780-01-9|1-(2,4-dinitrophenyl)-4-propyl-piperidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(2,4-dinitrophenyl)-4-propyl-piperidine |
|---|
| CAS Number | 19780-01-9 | Molecular Weight | 293.31800 |
|---|
| Density | 1.224g/cm3 | Boiling Point | 442.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.2ºC |
|---|
Names
| Name | 1-(2,4-dinitrophenyl)-4-propyl-piperidine |
|---|
Chemical & Physical Properties
| Density | 1.224g/cm3 |
|---|
| Boiling Point | 442.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19N3O4 |
|---|
| Molecular Weight | 293.31800 |
|---|
| Flash Point | 221.2ºC |
|---|
| Exact Mass | 293.13800 |
|---|
| PSA | 94.88000 |
|---|
| LogP | 4.63090 |
|---|
| Vapour Pressure | 5.11E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | LPHVJKBVQMLKDM-UHFFFAOYSA-N |
|---|
| SMILES | CCCC1CCN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
|---|