Introduction：Basic information about CAS 2673-15-6|2-Hexanol,3,3,4,4,5,5,6,6-octafluoro-2-methyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Hexanol,3,3,4,4,5,5,6,6-octafluoro-2-methyl- |
|---|
| CAS Number | 2673-15-6 | Molecular Weight | 260.12500 |
|---|
| Density | 1.4g/cm3 | Boiling Point | 163.4ºC at 760mmHg |
|---|
| Molecular Formula | C7H8F8O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 52.6ºC |
|---|
Names
| Name | 3,3,4,4,5,5,6,6-octafluoro-2-methylhexan-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4g/cm3 |
|---|
| Boiling Point | 163.4ºC at 760mmHg |
|---|
| Molecular Formula | C7H8F8O |
|---|
| Molecular Weight | 260.12500 |
|---|
| Flash Point | 52.6ºC |
|---|
| Exact Mass | 260.04500 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 2.92830 |
|---|
| Vapour Pressure | 0.705mmHg at 25°C |
|---|
| Index of Refraction | 1.322 |
|---|
| InChIKey | RTFCOQNRRQBMIT-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(O)C(F)(F)C(F)(F)C(F)(F)C(F)F |
|---|
Synonyms
| 3,3,4,4,5,5,6,6-octafluoro-2-methyl-2-hexanol |
| 3,3,4,4,5,5,6,6-Octafluor-2-methyl-hexan-2-ol |
| 1,1-dimethyl-2,2,3,3,4,4,5,5-octafluoropentanol |
| 2-Methyl-3,3,4,4,5,5,6,6-Octafluoro-2-Hexanol |
