Introduction：Basic information about CAS 14498-33-0|Benzoic acid,2-[[(2-oxo-2-phenylethyl)amino]carbonyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,2-[[(2-oxo-2-phenylethyl)amino]carbonyl]- |
|---|
| CAS Number | 14498-33-0 | Molecular Weight | 283.27900 |
|---|
| Density | 1.298g/cm3 | Boiling Point | 556.3ºC at 760mmHg |
|---|
| Molecular Formula | C16H13NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 290.2ºC |
|---|
Names
| Name | 2-(phenacylcarbamoyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.298g/cm3 |
|---|
| Boiling Point | 556.3ºC at 760mmHg |
|---|
| Molecular Formula | C16H13NO4 |
|---|
| Molecular Weight | 283.27900 |
|---|
| Flash Point | 290.2ºC |
|---|
| Exact Mass | 283.08400 |
|---|
| PSA | 83.47000 |
|---|
| LogP | 2.38840 |
|---|
| Vapour Pressure | 3.29E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | VQRLTLHFHCPVEM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CNC(=O)c1ccccc1C(=O)O)c1ccccc1 |
|---|
Synonyms
| N-phenacyl-phthalamic acid |
| 2-[(2-oxo-2-phenylethyl)carbamoyl]benzoic acid |
| N-Phenacyl-phthalmonoamid |
| N-(2-oxo-2-phenyl-ethyl)-phthalamic acid |
| benzoic acid,2-[[(2-oxo-2-phenylethyl)amino]carbonyl] |
| N-Phenacyl-phthalamidsaeure |
