Introduction：Basic information about CAS 14949-01-0|Acetamide,N-[4-(aminosulfonyl)phenyl]-2-chloro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetamide,N-[4-(aminosulfonyl)phenyl]-2-chloro- |
|---|
| CAS Number | 14949-01-0 | Molecular Weight | 248.68700 |
|---|
| Density | 1.527g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H9ClN2O3S | Melting Point | 217 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-chloro-N-(4-sulfamoylphenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.527g/cm3 |
|---|
| Melting Point | 217 °C |
|---|
| Molecular Formula | C8H9ClN2O3S |
|---|
| Molecular Weight | 248.68700 |
|---|
| Exact Mass | 248.00200 |
|---|
| PSA | 97.64000 |
|---|
| LogP | 2.36540 |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | WBDDNKFSVVIFOG-UHFFFAOYSA-N |
|---|
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCl)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| N-[4-(aminosulfonyl)phenyl]-2-chloroacetamide |
| 4-(2-chloroethanoylamino)benzenesulfonamide |
| 2-chloro-N-(4-sulphamoylphenyl)-acetamide |
| F0307-0451 |
| [(4-aminosulfonylphenyl)aminocarbonylmethyl]chloride |
| 2-chloro-N-(4-sulfamoyl-phenyl)acetamide |
| 2-Chloro-N-(sulfamoylphenyl)acetamide |
