Introduction：Basic information about CAS 112-11-8|Oleic acid, isopropyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Oleic acid, isopropyl ester |
|---|
| CAS Number | 112-11-8 | Molecular Weight | 324.541 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 396.8±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H40O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 88.6±20.4 °C |
|---|
Names
| Name | isopropyl oleate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 396.8±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H40O2 |
|---|
| Molecular Weight | 324.541 |
|---|
| Flash Point | 88.6±20.4 °C |
|---|
| Exact Mass | 324.302826 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 9.04 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.455 |
|---|
| InChIKey | PZQSQRCNMZGWFT-QXMHVHEDSA-N |
|---|
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(C)C |
|---|
Synonyms
| 9-Octadecenoic acid (9Z)-,1-methylethyl ester |
| 2-propyl oleate |
| EINECS 203-935-4 |
| Isopropyl (9Z)-octadec-9-enoate |
| Oleic acid, isopropyl ester |
| (Z)-9-Octadecenoic acid 1-methylethyl ester |
| Oelsaeure-isopropylester |
| oleic acid isopropyl ester |
| Isopropyl (9Z)-9-octadecenoate |
| Oleic acid, isopropyl ester (8CI) |
| 9-Octadecenoic acid, 1-methylethyl ester, (9Z)- |
| 9-Octadecenoicacid(Z)-,1-methylethylester |
| Isopropyl (Z)-9-octadecenoate |
| iso-propyl oleate |
| cis-octadec-9-enoic acid isopropyl ester |
| Isopropyloleat |
