Introduction：Basic information about CAS 12225-86-4|reactive orange 14, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | reactive orange 14 |
|---|
| CAS Number | 12225-86-4 | Molecular Weight | 631.38300 |
|---|
| Density | 2.01g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C19H12Cl2N8O9S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | reactive orange 14 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.01g/cm3 |
|---|
| Molecular Formula | C19H12Cl2N8O9S2 |
|---|
| Molecular Weight | 631.38300 |
|---|
| Exact Mass | 629.95500 |
|---|
| PSA | 270.89000 |
|---|
| LogP | 4.09030 |
|---|
| Index of Refraction | 1.836 |
|---|
| InChIKey | IHRFTCGTRALYFG-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1N=Nc1ccc(Nc2nc(Cl)nc(Cl)n2)cc1S(=O)(=O)O |
|---|
Synonyms
| Dinactive Yellow M4R |
| Monaryl Yellow M4R |
| Goldazol Yellow 4RC |
| Chemictive Yellow 4R |
| Polkative Yellow PX-4R |
| Mikacion Yellow 4RS |
| Begative Yellow CD-4R |
| REACTIVEORANGENO14 |
| Acticrom Yellow F4R |
