Introduction：Basic information about CAS 55119-10-3|1,3,6-tribromo-9H-carbazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,6-tribromo-9H-carbazole |
|---|
| CAS Number | 55119-10-3 | Molecular Weight | 403.89500 |
|---|
| Density | 2.188g/cm3 | Boiling Point | 500.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H6Br3N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 256.7ºC |
|---|
Names
| Name | 1,3,6-tribromo-9H-carbazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.188g/cm3 |
|---|
| Boiling Point | 500.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H6Br3N |
|---|
| Molecular Weight | 403.89500 |
|---|
| Flash Point | 256.7ºC |
|---|
| Exact Mass | 400.80500 |
|---|
| PSA | 15.79000 |
|---|
| LogP | 5.60860 |
|---|
| Index of Refraction | 1.807 |
|---|
| InChIKey | LMYCYTOEMHSFKR-UHFFFAOYSA-N |
|---|
| SMILES | Brc1ccc2[nH]c3c(Br)cc(Br)cc3c2c1 |
|---|
Synonyms
| HMS547F21 |
| 1,3,6-Tribromcarbazol |
| 1,3,6-tribromocarbazole |
