CAS 3813-52-3|Nadic acid
Introduction:Basic information about CAS 3813-52-3|Nadic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nadic acid | ||
|---|---|---|---|
| CAS Number | 3813-52-3 | Molecular Weight | 182.173 |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 419.8±45.0 °C at 760 mmHg |
| Molecular Formula | C9H10O4 | Melting Point | 175ºC (DEC.) |
| MSDS | ChineseUSA | Flash Point | 221.8±25.2 °C |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | 5-Norbornene-2,3-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.8±45.0 °C at 760 mmHg |
| Melting Point | 175ºC (DEC.) |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.173 |
| Flash Point | 221.8±25.2 °C |
| Exact Mass | 182.057907 |
| PSA | 74.60000 |
| LogP | 0.35 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | NIDNOXCRFUCAKQ-UHFFFAOYSA-N |
| SMILES | O=C(O)C1C2C=CC(C2)C1C(=O)O |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Packaging Group | I; II; III |
| Hazard Class | 6.1 |
| HS Code | 2917209090 |
Customs
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
Synonyms
| Nadic acid |
| Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, (1S,2R,3R,4S)- |
| Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic Acid |
| Bicyclo[2.2.1]hept-5-ene-2,3- dicarboxylic acid |
| Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, (1S,2R,3S,4S)- |
| Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, (1R,2S,3R,4S)- |
| (1R,2S,3R,4S)-Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| (1R,2S,3R,4S)-rel-Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| (1S,2R,3S,4S)-Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| 5-Norbornene-endo-2,3-dicarboxylic Acid |
| ENDO-METHYLENETETRAHYDROPHTHALIC ACID |
| 3,6-endo-methylenecyclohex-4-ene-1,2-dicarboxylic acid |
| EINECS 223-301-0 |
| 5-Norbornene -2,3-dicarboxylic acid |
| (1S,2R,3R,4S)-Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| cis-3,6-Endomethylene-1,2,3,6-tetrahydrophthalic Acid |
| MFCD00152680 |
| 3,6-Endomethylene-D4-tetrahydrophthalic acid |
| Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, (endo,endo)- |
| Carbic acid |
| 8,9,10-trinorborn-5-ene-2,3-dicarboxylic acid |
