Introduction：Basic information about CAS 6708-61-8|Cadion 2B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cadion 2B |
|---|
| CAS Number | 6708-61-8 | Molecular Weight | 396.40100 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 603.8ºC at 760 mmHg |
|---|
| Molecular Formula | C22H16N6O2 | Melting Point | 175℃ |
|---|
| MSDS | / | Flash Point | 319ºC |
|---|
Names
| Name | N-[(4-nitronaphthalen-1-yl)diazenyl]-4-phenyldiazenylaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 603.8ºC at 760 mmHg |
|---|
| Melting Point | 175℃ |
|---|
| Molecular Formula | C22H16N6O2 |
|---|
| Molecular Weight | 396.40100 |
|---|
| Flash Point | 319ºC |
|---|
| Exact Mass | 396.13300 |
|---|
| PSA | 107.29000 |
|---|
| LogP | 7.87040 |
|---|
| Index of Refraction | 1.686 |
|---|
| InChIKey | XXHDVJVLFBXOGN-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(N=NNc2ccc(N=Nc3ccccc3)cc2)c2ccccc12 |
|---|
Synonyms
