Introduction：Basic information about CAS 5393-41-9|9H-Carbazole,3-nitro-9-nitroso-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9H-Carbazole,3-nitro-9-nitroso- |
|---|
| CAS Number | 5393-41-9 | Molecular Weight | 241.20200 |
|---|
| Density | 1.52g/cm3 | Boiling Point | 459.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H7N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 231.6ºC |
|---|
Names
| Name | 3-nitro-9-nitrosocarbazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.52g/cm3 |
|---|
| Boiling Point | 459.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H7N3O3 |
|---|
| Molecular Weight | 241.20200 |
|---|
| Flash Point | 231.6ºC |
|---|
| Exact Mass | 241.04900 |
|---|
| PSA | 80.18000 |
|---|
| LogP | 3.75540 |
|---|
| Index of Refraction | 1.737 |
|---|
| InChIKey | UTBGPZHMURQBBF-UHFFFAOYSA-N |
|---|
| SMILES | O=Nn1c2ccccc2c2cc([N+](=O)[O-])ccc21 |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-nitro-9-nitroso-carbazole |
| 9H-Carbazole,3-nitro-9-nitroso |
| 3-nitro-9-nitroso-9H-carbazole |
| N-Nitroso-3-nitro-carbazol |
| 3-Nitro-o-nitrosocarbazole |
| 9-Nitroso-3-nitro-carbazol |
| Carbazole,3-nitro-9-nitroso |
