Introduction:Basic information about CAS 201532-42-5|Fmoc-β-(2-thienyl)-D-alanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-β-(2-thienyl)-D-alanine |
|---|
| CAS Number | 201532-42-5 | Molecular Weight | 393.456 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 623.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H19NO4S | Melting Point | 169ºC |
|---|
| MSDS | / | Flash Point | 330.8±31.5 °C |
|---|
Names
| Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 623.4±55.0 °C at 760 mmHg |
|---|
| Melting Point | 169ºC |
|---|
| Molecular Formula | C22H19NO4S |
|---|
| Molecular Weight | 393.456 |
|---|
| Flash Point | 330.8±31.5 °C |
|---|
| Exact Mass | 393.103485 |
|---|
| PSA | 103.87000 |
|---|
| LogP | 5.08 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.650 |
|---|
| InChIKey | PXBMQFMUHRNKTG-HXUWFJFHSA-N |
|---|
| SMILES | O=C(NC(Cc1cccs1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
|---|
| Storage condition | Store at RT. |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S24/25 |
|---|
Synonyms
| (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-yl-propanoate |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-(2-thienyl)-L-alanine |
| Fmoc-3-(2-Thienyl)-D-alanine |
| (2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-(2-thienyl)propanoic acid |
| (2R)-2-[[9H-fluoren-9-ylmethoxy(oxo)methyl]amino]-3-thiophen-2-ylpropanoate |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-(2-thienyl)-D-alanine |
| MFCD00065677 |
| (R)-2-[[[(9H-Fluoren-9-yl)methoxy]carbonyl]amino]-3-(thiophen-2-yl)propanoicacid |
| 2-Thiophenepropanoic acid, α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (αS)- |
| 2-Thiophenepropanoic acid, α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (αR)- |
| FMoc-β-(2-thienyl)-D-alanine |
| Fmoc-D-Thi-OH |
| FMoc-D-2-thienylalanine |
| FMOC-D-THI-OH (FMOC-D-3-(2-THIENYL)-ALANINE) |