Introduction:Basic information about CAS 201484-12-0|Fmoc-d-dab-oh, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-d-dab-oh |
|---|
| CAS Number | 201484-12-0 | Molecular Weight | 340.37300 |
|---|
| Density | 1.294 g/cm3 | Boiling Point | 593.654ºC at 760 mmHg |
|---|
| Molecular Formula | C19H20N2O4 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 312.831ºC |
|---|
Names
| Name | (2R)-4-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.294 g/cm3 |
|---|
| Boiling Point | 593.654ºC at 760 mmHg |
|---|
| Molecular Formula | C19H20N2O4 |
|---|
| Molecular Weight | 340.37300 |
|---|
| Flash Point | 312.831ºC |
|---|
| Exact Mass | 340.14200 |
|---|
| PSA | 101.65000 |
|---|
| LogP | 3.41830 |
|---|
| InChIKey | ZZDRDGKSMGGBDI-QGZVFWFLSA-N |
|---|
| SMILES | NCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-aminobutanoic acid |
| (R)-2-(Fmoc-amino)-4-aminobutanoic acid |
| I04-1228 |
| Fmoc-Asn-ol |
| (2R)-4-amino-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}butanoic acid |
| Fmoc-D-Dab-OH |