Introduction：Basic information about CAS 198543-64-5|Fmoc-D-tert-leucine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-D-tert-leucine |
|---|
| CAS Number | 198543-64-5 | Molecular Weight | 353.412 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 554.1±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H23NO4 | Melting Point | 126-130ºC |
|---|
| MSDS | / | Flash Point | 288.9±25.4 °C |
|---|
Names
| Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 554.1±33.0 °C at 760 mmHg |
|---|
| Melting Point | 126-130ºC |
|---|
| Molecular Formula | C21H23NO4 |
|---|
| Molecular Weight | 353.412 |
|---|
| Flash Point | 288.9±25.4 °C |
|---|
| Exact Mass | 353.162720 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 4.77 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | VZOHGJIGTNUNNC-SFHVURJKSA-N |
|---|
| SMILES | CC(C)(C)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
|---|
| Storage condition | -15°C |
|---|
Synonyms
| (2R)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-3,3-dimethylbutanoic acid |
| Fmoc-L-tert-leucine |
| Fmoc-D-tert-Leu-OH |
| Fmoc-(D-tert-leucine) |
| Fmoc-tBu-Gly-OH |
| Fmoc-D-Tle-OH |
| L-Valine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-methyl- |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-methyl-L-valine |
| Fmoc-tert-leucine |
| (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3,3-dimethylbutanoic acid |
