Introduction:Basic information about CAS 80102-23-4|Boc-2-chloro-D-phenylalanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-2-chloro-D-phenylalanine |
|---|
| CAS Number | 80102-23-4 | Molecular Weight | 299.750 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 452.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18ClNO4 | Melting Point | 93ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 227.5±27.3 °C |
|---|
Names
| Name | Boc-D-Phe(2-Cl)-OH |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 452.5±40.0 °C at 760 mmHg |
|---|
| Melting Point | 93ºC |
|---|
| Molecular Formula | C14H18ClNO4 |
|---|
| Molecular Weight | 299.750 |
|---|
| Flash Point | 227.5±27.3 °C |
|---|
| Exact Mass | 299.092438 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 3.56 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.539 |
|---|
| InChIKey | TUUQJNHCVFJMPU-LLVKDONJSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1Cl)C(=O)O |
|---|
| Storage condition | 2~8°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-Chloro-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine |
| (S)-2-((tert-Butoxycarbonyl)amino)-3-(2-chlorophenyl)propanoic acid |
| Boc-L-2-Chlorophenylalanine |
| (2R)-3-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| L-Phenylalanine, 2-chloro-N-[(1,1-dimethylethoxy)carbonyl]- |
| Boc-L-2-Chlorophe |
| Boc-D-Phe(2-Cl)-OH |
| Boc-2-chloro-L-phenylalanine |
| N-(tert-Butoxycarbonyl)-2-chloro-L-phenylalanine |
| (2S)-3-(2-Chlorophenyl)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| Boc-Phe(2-Cl)-OH |
| (2S)-2-[(tert-butoxy)carbonylamino]-3-(2-chlorophenyl)propanoic acid |
| MFCD00801056 |
| Boc-D-2-Chlorophenylalanine |
| Boc-2-chloro-D-phenylalanine |
| Boc-D-2-Chlorophe |