Introduction：Basic information about CAS 158741-21-0|Boc-L-3-Nitrophenylalanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-L-3-Nitrophenylalanine |
|---|
| CAS Number | 158741-21-0 | Molecular Weight | 310.302 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 506.9±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 260.3±28.7 °C |
|---|
Names
| Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrophenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 506.9±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18N2O6 |
|---|
| Molecular Weight | 310.302 |
|---|
| Flash Point | 260.3±28.7 °C |
|---|
| Exact Mass | 310.116486 |
|---|
| PSA | 121.45000 |
|---|
| LogP | 2.69 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | OWTGPXDXLMNQKK-LLVKDONJSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(Cc1cccc([N+](=O)[O-])c1)C(=O)O |
|---|
| Storage condition | Store at R.T. |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| D-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-3-nitro- |
| (2R)-2-[(tert-butoxycarbonyl)amino]-3-(3-nitrophenyl)propanoic acid |
| MFCD01317702 |
| N-(tert-Butoxycarbonyl)-3-nitro-L-phenylalanine |
| Boc-3-Nitro-D-phenylalanine |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-nitro-D-phenylalanine |
| D-N-Boc-3-nitrophenylalanine |
| (2S)-2-[(tert-Butoxycarbonyl)amino]- 3-(3-nitrophenyl)propionic acid |
| (2S)-2-[(tert-Butoxycarbonyl)amino]-3-(3-nitrophenyl)propanoic acid |
| Boc-L-3-Nitrophenylalanine |
| L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-3-nitro- |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-nitro-L-phenylalanine |
| Boc-3-nitro-L-phenylalanine |
| Boc-D-3-nitrophenylalanine |
| Boc-L-phe(3-NO2)-OH |
| N-(tert-Butoxycarbonyl)-3-nitro-D-phenylalanine |
| (S)-2-[(tert-Butoxycarbonyl)amino]- 3-(3-nitrophenyl)propionic acid |
| WNR C1YVQMVOX1&1&1 &&L or S Form |
