Introduction:Basic information about CAS 205526-27-8|Fmoc-Phe(3-CF3)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-Phe(3-CF3)-OH |
|---|
| CAS Number | 205526-27-8 | Molecular Weight | 455.426 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 611.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H20F3NO4 | Melting Point | 147-157ºC |
|---|
| MSDS | USA | Flash Point | 323.5±31.5 °C |
|---|
Names
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 611.2±55.0 °C at 760 mmHg |
|---|
| Melting Point | 147-157ºC |
|---|
| Molecular Formula | C25H20F3NO4 |
|---|
| Molecular Weight | 455.426 |
|---|
| Flash Point | 323.5±31.5 °C |
|---|
| Exact Mass | 455.134430 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 5.98 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | AJMRBDCOLBEYRZ-QFIPXVFZSA-N |
|---|
| SMILES | O=C(NC(Cc1cccc(C(F)(F)F)c1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| (2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-[3-(trifluoromethyl)phenyl]propanoic acid |
| (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-(trifluoromethyl)-D-phenylalanine |
| Fmoc-D-phe(4-CF3)-OH |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-(trifluoromethyl)-L-phenylalanine |
| Fmoc-3-Trifluoromethyl-L-phenylalanine |
| MFCD00672555 |
| D-Phenylalanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-(trifluoromethyl)- |
| Fmoc-L-3-Trifluoromethylphenylalanine |
| L-Phenylalanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-4-(trifluoromethyl)- |
| Fmoc-Phe(3-CF3)-OH |