Introduction:Basic information about CAS 204260-38-8|Fmoc-D-phe(4-me)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-D-phe(4-me)-OH |
|---|
| CAS Number | 204260-38-8 | Molecular Weight | 401.454 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 629.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H23NO4 | Melting Point | 168ºC |
|---|
| MSDS | / | Flash Point | 334.3±31.5 °C |
|---|
Names
| Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 629.1±55.0 °C at 760 mmHg |
|---|
| Melting Point | 168ºC |
|---|
| Molecular Formula | C25H23NO4 |
|---|
| Molecular Weight | 401.454 |
|---|
| Flash Point | 334.3±31.5 °C |
|---|
| Exact Mass | 401.162720 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 5.87 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.626 |
|---|
| InChIKey | UXLHLZHGQPDMJQ-HSZRJFAPSA-N |
|---|
| SMILES | Cc1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |
|---|
| Storage condition | 2~8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid |
| Fmoc-L-phe(4-me)-OH |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-methyl-L-phenylalanine |
| Fmoc-Phe(4-Me)-OH |
| MFCD00270196 |
| (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(p-tolyl)propanoic acid |
| Fmoc-D-phe(4-me)-OH |
| AmbotzFAA1683 |
| Fmoc-4-methyl-D-phenylalanine |
| L-Phenylalanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-4-methyl- |
| FMOC-D-4-METHYLPHENYLALANINE |
| (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-(4-methylphenyl)propanoic acid |
| FMOC-P-ME-D-PHE-OH |
| Fmoc-D-4-Methylphe |
| Fmoc-L-4-Methylphe |