Introduction：Basic information about CAS 214852-45-6|Fmoc-D-cis-Hyp-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-D-cis-Hyp-OH |
|---|
| CAS Number | 214852-45-6 | Molecular Weight | 353.369 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 595.5±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H19NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 314.0±30.1 °C |
|---|
Names
| Name | (2R,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 595.5±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H19NO5 |
|---|
| Molecular Weight | 353.369 |
|---|
| Flash Point | 314.0±30.1 °C |
|---|
| Exact Mass | 353.126312 |
|---|
| PSA | 87.07000 |
|---|
| LogP | 1.73 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.658 |
|---|
| InChIKey | GOUUPUICWUFXPM-KZULUSFZSA-N |
|---|
| SMILES | O=C(O)C1CC(O)CN1C(=O)OCC1c2ccccc2-c2ccccc21 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Synonyms
| Fmoc-cis-D-4-Hydroxyproline |
| 1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(9H-fluoren-9-ylmethyl) ester, (2R,4R)- |
| (4R)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-hydroxy-D-proline |
| Fmoc-cis-4-Hydroxy-D-proline |
| (2R,4R)-N-FMOC-4-HYDROXY-D-PROLINE |
| FMOC-D-CIS-HYP-OH |
| Fomc-Cis-D-Hyp-OH |
