Introduction:Basic information about CAS 19013-15-1|4-Methyl-3-nitrobenzoic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Methyl-3-nitrobenzoic acid ethyl ester |
|---|
| CAS Number | 19013-15-1 | Molecular Weight | 209.19900 |
|---|
| Density | 1.217g/cm3 | Boiling Point | 312.38ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 137.438ºC |
|---|
Names
| Name | Ethyl 4-methyl-3-nitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.217g/cm3 |
|---|
| Boiling Point | 312.38ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11NO4 |
|---|
| Molecular Weight | 209.19900 |
|---|
| Flash Point | 137.438ºC |
|---|
| Exact Mass | 209.06900 |
|---|
| PSA | 72.12000 |
|---|
| LogP | 2.60310 |
|---|
| Vapour Pressure | 0.001mmHg at 25°C |
|---|
| Index of Refraction | 1.541 |
|---|
| InChIKey | FWOACYVHDUBZDT-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccc(C)c([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-Methyl-3-nitro-benzoesaeure-aethylester |
| 3-nitro-4-methylbenzoic acid ethyl ester |
| 4-methyl-3-nitro-benzoic acid ethyl ester |
| 4-ethoxycarbonyl-2-nitrotoluene |
| 4-methyl-3-nitroethyl benzoate |
| ethyl 4-methyl-3-nitro-benzoate |
| Benzoic acid,4-methyl-3-nitro-,ethyl ester |
| 4-Methyl-3-nitrobenzoic acid ethyl ester |