Introduction：Basic information about CAS 149289-30-5|D,L N-Desmethyl Venlafaxine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | D,L N-Desmethyl Venlafaxine |
|---|
| CAS Number | 149289-30-5 | Molecular Weight | 263.37500 |
|---|
| Density | 1.067g/cm3 | Boiling Point | 396.2ºC at 760 mmHg |
|---|
| Molecular Formula | C16H25NO2 | Melting Point | 61-63ºC |
|---|
| MSDS | / | Flash Point | 193.4ºC |
|---|
Names
| Name | N-desmethylvenlafaxine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.067g/cm3 |
|---|
| Boiling Point | 396.2ºC at 760 mmHg |
|---|
| Melting Point | 61-63ºC |
|---|
| Molecular Formula | C16H25NO2 |
|---|
| Molecular Weight | 263.37500 |
|---|
| Flash Point | 193.4ºC |
|---|
| Exact Mass | 263.18900 |
|---|
| PSA | 41.49000 |
|---|
| LogP | 3.08430 |
|---|
| Vapour Pressure | 5.49E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.543 |
|---|
| InChIKey | MKAFOJAJJMUXLW-UHFFFAOYSA-N |
|---|
| SMILES | CNCC(c1ccc(OC)cc1)C1(O)CCCCC1 |
|---|
Synonyms
| rac N-Desmethyl Venlafaxine |
| 1-[1-(4-methoxyphenyl)-2-(methylamino)ethyl]cyclohexan-1-ol |
