Introduction：Basic information about CAS 149597-91-1|3,3-Diphenyl-D-alanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3-Diphenyl-D-alanine |
|---|
| CAS Number | 149597-91-1 | Molecular Weight | 241.285 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 389.2±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H15NO2 | Melting Point | 234 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 189.2±24.6 °C |
|---|
Names
| Name | (R)-2-Amino-3,3-diphenylpropanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 389.2±30.0 °C at 760 mmHg |
|---|
| Melting Point | 234 °C |
|---|
| Molecular Formula | C15H15NO2 |
|---|
| Molecular Weight | 241.285 |
|---|
| Flash Point | 189.2±24.6 °C |
|---|
| Exact Mass | 241.110275 |
|---|
| PSA | 63.32000 |
|---|
| LogP | 2.86 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.611 |
|---|
| InChIKey | PECGVEGMRUZOML-CQSZACIVSA-N |
|---|
| SMILES | NC(C(=O)O)C(c1ccccc1)c1ccccc1 |
|---|
| Storage condition | Store at 0°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| β-Phenyl-D-phenylalanine |
| 3,3-Diphenyl-D-alanine |
| (2S)-2-Amino-3,3-diphenylpropanoic acid |
| D-β-diphenylalanine |
| (2R)-2-amino-3,3-diphenylpropanoic acid |
| MFCD01631990 |
| L-Phenylalanine, β-phenyl- |
| D-Phenylalanine, β-phenyl- |
| β-Phenyl-L-phenylalanin |
| (R)-2-amino-3,3-diphenylpropanoic acid |
| β-Phenyl-L-phenylalanine |
| H-D-Ala(3,3-diphenyl)-OH |
