Introduction：Basic information about CAS 153823-58-6|2-Chloro-4-nitrophenyl 2,3,4,6-tetra-O-acetyl-a-D-glucopyranoside, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-4-nitrophenyl 2,3,4,6-tetra-O-acetyl-a-D-glucopyranoside |
|---|
| CAS Number | 153823-58-6 | Molecular Weight | 503.84100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C20H22ClNO12 | Melting Point | 117-119°C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-Chloro-4-nitrophenyl 2,3,4,6-tetra-O-acetyl-a-D-glucopyranoside |
|---|
Chemical & Physical Properties
| Melting Point | 117-119°C |
|---|
| Molecular Formula | C20H22ClNO12 |
|---|
| Molecular Weight | 503.84100 |
|---|
| Exact Mass | 503.08300 |
|---|
| PSA | 169.48000 |
|---|
| LogP | 2.23330 |
|---|
| Index of Refraction | 1.55 |
|---|
| InChIKey | QRNIUQCWYQOPLO-OBKDMQGPSA-N |
|---|
| SMILES | CC(=O)OCC1OC(Oc2ccc([N+](=O)[O-])cc2Cl)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
|---|
