Introduction：Basic information about CAS 15453-87-9|indium trifluoroacetylacetonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | indium trifluoroacetylacetonate |
|---|
| CAS Number | 15453-87-9 | Molecular Weight | 574.05600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H12F9InO6 | Melting Point | 118-9ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | indium trifluoroacetylacetonate |
|---|
Chemical & Physical Properties
| Melting Point | 118-9ºC |
|---|
| Molecular Formula | C15H12F9InO6 |
|---|
| Molecular Weight | 574.05600 |
|---|
| Exact Mass | 573.95300 |
|---|
| PSA | 78.90000 |
|---|
| LogP | 4.50750 |
|---|
| Appearance of Characters | Powder | white |
|---|
| InChIKey | JSFSIUKMFCYGBL-HVIQJXIVSA-K |
|---|
| SMILES | CC(=CC(=O)C(F)(F)F)O[In](OC(C)=CC(=O)C(F)(F)F)OC(C)=CC(=O)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
