Introduction：Basic information about CAS 154810-33-0|(1R,2S)-2-(4-fluorobenzoyl)cyclohexane-1-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1R,2S)-2-(4-fluorobenzoyl)cyclohexane-1-carboxylic acid |
|---|
| CAS Number | 154810-33-0 | Molecular Weight | 250.26600 |
|---|
| Density | 1.251g/cm3 | Boiling Point | 418.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H15FO3 | Melting Point | 136-139ºC |
|---|
| MSDS | / | Flash Point | 206.9ºC |
|---|
Names
| Name | (1R,2S)-2-(4-fluorobenzoyl)cyclohexane-1-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.251g/cm3 |
|---|
| Boiling Point | 418.6ºC at 760mmHg |
|---|
| Melting Point | 136-139ºC |
|---|
| Molecular Formula | C14H15FO3 |
|---|
| Molecular Weight | 250.26600 |
|---|
| Flash Point | 206.9ºC |
|---|
| Exact Mass | 250.10100 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 2.89940 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| InChIKey | RCCIJJKDNJBQIL-NWDGAFQWSA-N |
|---|
| SMILES | O=C(O)C1CCCCC1C(=O)c1ccc(F)cc1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
