Introduction：Basic information about CAS 156748-67-3|1-diethoxyphosphoryl-2,2,2-trifluoroethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-diethoxyphosphoryl-2,2,2-trifluoroethanol |
|---|
| CAS Number | 156748-67-3 | Molecular Weight | 236.12600 |
|---|
| Density | 1.321g/cm3 | Boiling Point | 259ºC at 760 mmHg |
|---|
| Molecular Formula | C6H12F3O4P | Melting Point | 59-63ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 110.5ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1-diethoxyphosphoryl-2,2,2-trifluoroethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.321g/cm3 |
|---|
| Boiling Point | 259ºC at 760 mmHg |
|---|
| Melting Point | 59-63ºC(lit.) |
|---|
| Molecular Formula | C6H12F3O4P |
|---|
| Molecular Weight | 236.12600 |
|---|
| Flash Point | 110.5ºC |
|---|
| Exact Mass | 236.04300 |
|---|
| PSA | 65.57000 |
|---|
| LogP | 2.13320 |
|---|
| Vapour Pressure | 0.00194mmHg at 25°C |
|---|
| Index of Refraction | 1.387 |
|---|
| InChIKey | ZVRKPNJLSIJXPF-UHFFFAOYSA-N |
|---|
| SMILES | CCOP(=O)(OCC)C(O)C(F)(F)F |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H312-H315-H319 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 2,2,2-Trifluoroethane-1-hydroxy-1-phosphonic acid diethyl ester |
| diethyl 1-hydroxy-2,2,2-trifluoroethylphosphonate |
| MFCD00239425 |
| diethyl 2,2,2-trifluoro-1-hydracetyloxyethanephosphonate |
