Introduction:Basic information about CAS 26021-20-5|N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-5-[(2-cyanoethyl)(2-hydroxyethyl)amino]-4-metho, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-5-[(2-cyanoethyl)(2-hydroxyethyl)amino]-4-methoxyphenyl]acetamide |
|---|
| CAS Number | 26021-20-5 | Molecular Weight | 550.31900 |
|---|
| Density | 1.61g/cm3 | Boiling Point | 826.2ºC at 760 mmHg |
|---|
| Molecular Formula | C20H20BrN7O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 453.5ºC |
|---|
Names
| Name | N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-5-[(2-cyanoethyl)(2-hydroxyethyl)amino]-4-methoxyphenyl]acetamide |
|---|
Chemical & Physical Properties
| Density | 1.61g/cm3 |
|---|
| Boiling Point | 826.2ºC at 760 mmHg |
|---|
| Molecular Formula | C20H20BrN7O7 |
|---|
| Molecular Weight | 550.31900 |
|---|
| Flash Point | 453.5ºC |
|---|
| Exact Mass | 549.06100 |
|---|
| PSA | 201.95000 |
|---|
| LogP | 5.47968 |
|---|
| Vapour Pressure | 6.53E-29mmHg at 25°C |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | MJEWVKATPDZNHU-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(N=Nc2c(Br)cc([N+](=O)[O-])cc2[N+](=O)[O-])c(NC(C)=O)cc1N(CCO)CCC#N |
|---|