Introduction：Basic information about CAS 57052-99-0|Dimethyl 2-Nitroisophthalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dimethyl 2-Nitroisophthalate |
|---|
| CAS Number | 57052-99-0 | Molecular Weight | 239.18200 |
|---|
| Density | 1.35 g/cm3 | Boiling Point | 360.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9NO6 | Melting Point | 121-123ºC |
|---|
| MSDS | / | Flash Point | 164.8ºC |
|---|
Names
| Name | dimethyl 5-nitrobenzene-1,3-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35 g/cm3 |
|---|
| Boiling Point | 360.2ºC at 760 mmHg |
|---|
| Melting Point | 121-123ºC |
|---|
| Molecular Formula | C10H9NO6 |
|---|
| Molecular Weight | 239.18200 |
|---|
| Flash Point | 164.8ºC |
|---|
| Exact Mass | 239.04300 |
|---|
| PSA | 98.42000 |
|---|
| LogP | 1.69120 |
|---|
| InChIKey | UZMFVOACDBUXRK-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cccc(C(=O)OC)c1[N+](=O)[O-] |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Methyl-2-nitroisophthalat |
| 2-Nitro-isophthalsaeure-dimethylester |
| EINECS 236-307-3 |
| 2-nitro-1,3-benzenedicarboxylic acid,dimethyl ester |
| dimethyl 2-nitroisophthalate |
| 2-nitro-isophthalic acid dimethyl ester |
| 1,3-Benzenedicarboxylic acid,5-nitro-,dimethyl ester |
| 5-Nitroisophthalic Acid Dimethyl Ester |
