Introduction：Basic information about CAS 3571-37-7|9-[2-(Butoxycarbonyl)phenyl]-6-(diethylamino)-N,N-diethyl-3H-xant hen-3-iminium chlori, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9-[2-(Butoxycarbonyl)phenyl]-6-(diethylamino)-N,N-diethyl-3H-xant hen-3-iminium chloride |
|---|
| CAS Number | 3571-37-7 | Molecular Weight | 535.11700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C32H39ClN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 9-[2-(Butoxycarbonyl)phenyl]-6-(diethylamino)-N,N-diethyl-3H-xant hen-3-iminium chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C32H39ClN2O3 |
|---|
| Molecular Weight | 535.11700 |
|---|
| Exact Mass | 534.26500 |
|---|
| PSA | 45.92000 |
|---|
| LogP | 5.18740 |
|---|
| InChIKey | RZODCBGJJQHDBD-UHFFFAOYSA-M |
|---|
| SMILES | CCCCOC(=O)c1ccccc1-c1c2ccc(=[N+](CC)CC)cc-2oc2cc(N(CC)CC)ccc12.[Cl-] |
|---|
Safety Information
Customs
| HS Code | 2922199090 |
|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Butylmercuric chloride |
| MERCURY,BUTYLCHLORO |
| Butylmercury chloride |
| Butylmerkurichlorid [Czech] |
| 9-(2-butoxycarbonyl-phenyl)-3,6-bis-diethylamino-xanthylium,chloride |
| Butylquecksilberchlorid |
| 2'-(6-diethylamino-3-diethylimino-3H-xanthen-9-yl)benzoic acid n-butyl ester chloride |
| Butyl-quecksilber(II)-chlorid |
| n-Butylquecksilberchlorid |
| rhodamine B n-butyl ester hydrochloride |
| 9-(2-Butoxycarbonyl-phenyl)-3,6-bis-diaethylamino-xanthylium,Chlorid |
| Butylchloromercury |
| n-Butylmercuric chloride |
| Butylmercurichlorid |
| butyl rhodamine B |
| rhodamine B n-butyl ester chloride |
| n-Butyl mercury chloride |
