Introduction：Basic information about CAS 261952-11-8|4-Methyl-3-(trifluoromethyl)benzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Methyl-3-(trifluoromethyl)benzoyl chloride |
|---|
| CAS Number | 261952-11-8 | Molecular Weight | 222.59200 |
|---|
| Density | 1.343g/cm3 | Boiling Point | 230.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H6ClF3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 93ºC |
|---|
Names
| Name | 4-Methyl-3-(trifluoromethyl)benzoyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.343g/cm3 |
|---|
| Boiling Point | 230.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H6ClF3O |
|---|
| Molecular Weight | 222.59200 |
|---|
| Flash Point | 93ºC |
|---|
| Exact Mass | 222.00600 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.39280 |
|---|
| Vapour Pressure | 0.0666mmHg at 25°C |
|---|
| Index of Refraction | 1.471 |
|---|
| InChIKey | KKGAVDJJVMSTSV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(=O)Cl)cc1C(F)(F)F |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
