Introduction：Basic information about CAS 83706-53-0|4-chloro-6-iodo-3-nitrotoluene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-chloro-6-iodo-3-nitrotoluene |
|---|
| CAS Number | 83706-53-0 | Molecular Weight | 297.47800 |
|---|
| Density | 1.962g/cm3 | Boiling Point | 342.2ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5ClINO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160.7ºC |
|---|
Names
| Name | 1-Chloro-5-iodo-4-methyl-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.962g/cm3 |
|---|
| Boiling Point | 342.2ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5ClINO2 |
|---|
| Molecular Weight | 297.47800 |
|---|
| Flash Point | 160.7ºC |
|---|
| Exact Mass | 296.90500 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.68440 |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | QKCJKTFOGQXDPE-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)cc1I |
|---|
Synonyms
| 1-chloro-5-iodo-4-methyl-2-nitro-benzene |
| 4-Chloro-6-iodo-3-nitrotoluene |
| EINECS 280-529-3 |
| 4-Chloro-2-iodo-5-nitrotoluene |
