Introduction：Basic information about CAS 111795-99-4|2-cyanomethyl-3-nitro-6-methoxy pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-cyanomethyl-3-nitro-6-methoxy pyridine |
|---|
| CAS Number | 111795-99-4 | Molecular Weight | 193.15900 |
|---|
| Density | 1.334g/cm3 | Boiling Point | 345.6ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7N3O3 | Melting Point | 116-117℃ (ethanol ) |
|---|
| MSDS | ChineseUSA | Flash Point | 162.8ºC |
|---|
| Symbol |
GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 2-(6-methoxy-3-nitropyridin-2-yl)acetonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.334g/cm3 |
|---|
| Boiling Point | 345.6ºC at 760 mmHg |
|---|
| Melting Point | 116-117℃ (ethanol ) |
|---|
| Molecular Formula | C8H7N3O3 |
|---|
| Molecular Weight | 193.15900 |
|---|
| Flash Point | 162.8ºC |
|---|
| Exact Mass | 193.04900 |
|---|
| PSA | 91.73000 |
|---|
| LogP | 1.58768 |
|---|
| Vapour Pressure | 6.09E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.563 |
|---|
| InChIKey | KOOPAOCWSWOMQI-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc([N+](=O)[O-])c(CC#N)n1 |
|---|
Safety Information
| Symbol |
GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H318 |
|---|
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T |
|---|
| Risk Phrases | 25-41 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 2811 6.1 / PGIII |
|---|
Synonyms
| (6-methoxy-3-nitropyridin-2-yl)acetonitrile |
| 2-pyridineacetonitrile,6-methoxy-3-nitro |
| 2-(3-nitro-6-methoxypyrid-2-yl)acetonitrile |
| 2-(6-Methoxy-3-nitropyrid-2-yl)acetonitrile |
| 6-Methoxy-3-nitropyridine-2-acetonitrile |
| (6-methoxy-3-nitro-2-pyridyl)acetonitrile |
| 2-cyanomethyl-6-methoxy-3-nitropyridine |
