Introduction：Basic information about CAS 260267-07-0|5,6-Difluoro-1H-indole-3-carbaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6-Difluoro-1H-indole-3-carbaldehyde |
|---|
| CAS Number | 260267-07-0 | Molecular Weight | 181.139 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 348.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H5F2NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 164.4±26.5 °C |
|---|
Names
| Name | 5,6-Difluoro-1H-indole-3-carbaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 348.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H5F2NO |
|---|
| Molecular Weight | 181.139 |
|---|
| Flash Point | 164.4±26.5 °C |
|---|
| Exact Mass | 181.033920 |
|---|
| PSA | 32.86000 |
|---|
| LogP | 1.78 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | JVFNNILBFBSJLA-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1c[nH]c2cc(F)c(F)cc12 |
|---|
Synonyms
| 5,6-bis(fluoranyl)-2,3-dihydroinden-1-one |
| 1H-Indole-3-carboxaldehyde, 5,6-difluoro- |
| 5,6-Difluoro-1-indanone |
| 5,6-difluoroindole-3-carboxaldehyde |
| 5,6-difluoroindole-2,3-dione |
| 1H-Inden-1-one,5,6-difluoro-2,3-dihydro |
| 5,6-difluoro-1H-indole-2,3-dione |
| 5,6-Difluoro-indanone |
| 5,6-difluoro-2,3-dihydro-1H-inden-1-one |
| 5,6-difluoro-indoline-2,3-dione |
| 5,6-Difluoro-indan-1-one |
| 5,6-Difluoro-1H-indole-3-carbaldehyde |
| 5,6-Difluor-indolin-2,3-dion |
