Introduction:Basic information about CAS 307353-97-5|Ethyl [(4-chloro-3-cyano-6-methoxy-7-quinolinyl)oxy]acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl [(4-chloro-3-cyano-6-methoxy-7-quinolinyl)oxy]acetate |
|---|
| CAS Number | 307353-97-5 | Molecular Weight | 320.72800 |
|---|
| Density | 1.36g/cm3 | Boiling Point | 470.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H13ClN2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 238.6ºC |
|---|
Names
| Name | Ethyl [(4-chloro-3-cyano-6-methoxy-7-quinolinyl)oxy]acetate |
|---|
Chemical & Physical Properties
| Density | 1.36g/cm3 |
|---|
| Boiling Point | 470.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H13ClN2O4 |
|---|
| Molecular Weight | 320.72800 |
|---|
| Flash Point | 238.6ºC |
|---|
| Exact Mass | 320.05600 |
|---|
| PSA | 81.44000 |
|---|
| LogP | 2.71038 |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | CYSBSNBGOQZFCI-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)COc1cc2ncc(C#N)c(Cl)c2cc1OC |
|---|