Introduction:Basic information about CAS 111578-32-6|metobenzuron, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | metobenzuron |
|---|
| CAS Number | 111578-32-6 | Molecular Weight | 400.46800 |
|---|
| Density | 1.21g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C22H28N2O5 | Melting Point | 92-93ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | metobenzuron |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.21g/cm3 |
|---|
| Melting Point | 92-93ºC |
|---|
| Molecular Formula | C22H28N2O5 |
|---|
| Molecular Weight | 400.46800 |
|---|
| Exact Mass | 400.20000 |
|---|
| PSA | 69.26000 |
|---|
| LogP | 4.99970 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | BXKKQFGRMSOANI-UHFFFAOYSA-N |
|---|
| SMILES | CON(C)C(=O)Nc1ccc(Oc2ccc3c(c2)OC(C)(OC)CC3(C)C)cc1 |
|---|
Synonyms
| N’-[4-[(3,4-dihydro-2-methoxy-2,4,4-trimethyl-2H-1-benzopyran-7-yl)oxy]phenyl]-N-methoxy-N-methylurea |
| (RS)-1-methoxy-3-(4-(2-methoxy-2,4,4-trimethylchroman-7-yloxy)phenyl)-1-methylurea |
| Metobenzuron [ISO] |
| Metobenzuron |
| rac-N-methoxy-N’-(4-{[(2R)-2-methoxy-2,4,4-trimethyl-3,4-dihydro-2H-1-benzopyran-7-yl]oxy}phenyl)-N-methylurea |
| Urea,N'-(4-((3,4-dihydro-2-methoxy-2,4,4-trimethyl-2H-1-benzopyran-7-yl)oxy)phenyl)-N-methoxy-N-methyl |
| 1-methoxy-3-[4-[(2-methoxy-2,4,4-trimethyl-3H-chromen-7-yl)oxy]phenyl]-1-methylurea |
| (RS)-1-methoxy-3-[4-(2-methoxy-2,4,4-trimethylchroman-7-yloxy)phenyl]-1-methylurea |
| N'-(4-((3,4-dihydro-2-methoxy-2,4,4-trimethyl-2H-1-benzopyran-7-yl)oxy)phenyl)-N-methoxy-N-methylurea |