Introduction:Basic information about CAS 87027-09-6|CHF 10-21, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | CHF 10-21 |
|---|
| CAS Number | 87027-09-6 | Molecular Weight | 415.46300 |
|---|
| Density | 1.39g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C20H21N3O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-Methyl-1,1-dioxido-3-(2-pyridinylcarbamoyl)-2H-1,2-benzothiazin -4-yl pivalate |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Molecular Formula | C20H21N3O5S |
|---|
| Molecular Weight | 415.46300 |
|---|
| Exact Mass | 415.12000 |
|---|
| PSA | 117.54000 |
|---|
| LogP | 4.28050 |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | LGDAGYXJBDILKZ-UHFFFAOYSA-N |
|---|
| SMILES | CN1C(C(=O)Nc2ccccn2)=C(OC(=O)C(C)(C)C)c2ccccc2S1(=O)=O |
|---|