Introduction：Basic information about CAS 67193-90-2|1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12- pentacosafluorodode, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12- pentacosafluorododecane |
|---|
| CAS Number | 67193-90-2 | Molecular Weight | 698.99200 |
|---|
| Density | 1.856 | Boiling Point | 222ºC |
|---|
| Molecular Formula | C12BrF25 | Melting Point | 87-88ºC |
|---|
| MSDS | / | Flash Point | 88ºC |
|---|
Names
| Name | 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12- pentacosafluorododecane |
|---|
Chemical & Physical Properties
| Density | 1.856 |
|---|
| Boiling Point | 222ºC |
|---|
| Melting Point | 87-88ºC |
|---|
| Molecular Formula | C12BrF25 |
|---|
| Molecular Weight | 698.99200 |
|---|
| Flash Point | 88ºC |
|---|
| Exact Mass | 697.87800 |
|---|
| LogP | 8.88940 |
|---|
| Index of Refraction | 1.293 |
|---|
| InChIKey | XLDCRDVOTVYYPR-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br |
|---|
