Introduction：Basic information about CAS 57905-76-7|NITROCARBAZOLE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | NITROCARBAZOLE |
|---|
| CAS Number | 57905-76-7 | Molecular Weight | 212.20400 |
|---|
| Density | 1.435g/cm3 | Boiling Point | 448.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H8N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 225.1ºC |
|---|
Names
| Name | 4-Nitro-9H-carbazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.435g/cm3 |
|---|
| Boiling Point | 448.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H8N2O2 |
|---|
| Molecular Weight | 212.20400 |
|---|
| Flash Point | 225.1ºC |
|---|
| Exact Mass | 212.05900 |
|---|
| PSA | 61.61000 |
|---|
| LogP | 3.75250 |
|---|
| Index of Refraction | 1.795 |
|---|
| InChIKey | MQVWPHWBMNOCAT-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc2[nH]c3ccccc3c12 |
|---|
Synonyms
| 9H-Carbazole,4-nitro |
| 1-nitrocarbazole |
| 4-Nitro-carbazol |
| 4-Nitrocarbazole |
