Introduction:Basic information about CAS 57311-64-5|2-[2-[4-(1H-Indol-3-yl)-1-piperidinyl]ethyl]-1H-isoindole-1,3(2H)-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[2-[4-(1H-Indol-3-yl)-1-piperidinyl]ethyl]-1H-isoindole-1,3(2H)-dione |
|---|
| CAS Number | 57311-64-5 | Molecular Weight | 373.44800 |
|---|
| Density | 1.286 | Boiling Point | / |
|---|
| Molecular Formula | C23H23N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-{2-[4-(1H-Indol-3-yl)-1-piperidinyl]ethyl}-1H-isoindole-1,3(2H) -dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.286 |
|---|
| Molecular Formula | C23H23N3O2 |
|---|
| Molecular Weight | 373.44800 |
|---|
| Exact Mass | 373.17900 |
|---|
| PSA | 56.41000 |
|---|
| LogP | 3.51930 |
|---|
| InChIKey | VIGMLAAKWQNCMP-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)N1CCN1CCC(c2c[nH]c3ccccc23)CC1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| N-(2-(4-(1H-indol-3-yl)piperidin-1-yl)ethyl)phthalimide |
| N-Nicotinoyltyramine |
| 3-Nicotinyltryptamine |
| Nicotinsaeure-(4-hydroxy-phenaethylamid) |
| N-[2-(4-indol-3-yl-piperidin-1-yl)-ethyl]-phthalimide |
| nicotinic acid-(4-hydroxy-phenethylamide) |
| 3-Pyridinecarboxamide,N-(2-(4-hydroxyphenyl)ethyl) |
| marmamide-A |
| N-[2-(4-hydroxyphenyl)ethyl]-3-pyridinecarboxamide |
| Nicotinamide,N-(p-hydroxyphenethyl) |
| Nicotinoyltyramine |
| N-(Pyrid-3-ylcarbonyl)-tyramin |
| 1-(2-phthalimidoethyl)-4-(3-indolyl)piperidine |
| N-(3-Pyridylcarbonyl)tyramine |
| 2-(2-(4-indol-3-ylpiperidyl)ethyl)isoindoline-1,3-dione |