Introduction：Basic information about CAS 57186-90-0|3,4'-dibromobiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4'-dibromobiphenyl |
|---|
| CAS Number | 57186-90-0 | Molecular Weight | 312.00000 |
|---|
| Density | 1.667g/cm3 | Boiling Point | 348ºC at 760mmHg |
|---|
| Molecular Formula | C12H8Br2 | Melting Point | 75-76 °C |
|---|
| MSDS | / | Flash Point | 191.3ºC |
|---|
Names
| Name | 1-bromo-3-(4-bromophenyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.667g/cm3 |
|---|
| Boiling Point | 348ºC at 760mmHg |
|---|
| Melting Point | 75-76 °C |
|---|
| Molecular Formula | C12H8Br2 |
|---|
| Molecular Weight | 312.00000 |
|---|
| Flash Point | 191.3ºC |
|---|
| Exact Mass | 309.89900 |
|---|
| LogP | 4.87860 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | DLAKCVTXQRIHEY-UHFFFAOYSA-N |
|---|
| SMILES | Brc1ccc(-c2cccc(Br)c2)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| PBB 13 |
| 3,4'-Dibromo-1,1'-biphenyl |
| 3,4'-Dibrom-biphenyl |
| 1,1'-Biphenyl,3,4'-dibromo |
| 3,4'-Dibromobiphenyl |
| Biphenyl,3,4'-dibromo-(6CI) |
