Introduction：Basic information about CAS 151276-10-7|1,2-Dichloro-4-(trifluoromethoxy)benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-Dichloro-4-(trifluoromethoxy)benzene |
|---|
| CAS Number | 151276-10-7 | Molecular Weight | 230.999 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 187.1±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H3Cl2F3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 66.9±25.9 °C |
|---|
Names
| Name | 1,2-Dichloro-4-(trifluoromethoxy)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 187.1±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H3Cl2F3O |
|---|
| Molecular Weight | 230.999 |
|---|
| Flash Point | 66.9±25.9 °C |
|---|
| Exact Mass | 229.951309 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 4.56 |
|---|
| Vapour Pressure | 0.9±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.474 |
|---|
| InChIKey | SXBGDKFVGXZJDU-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)Oc1ccc(Cl)c(Cl)c1 |
|---|
Synonyms
| 1,2-dichloro-4-trifluoromethoxy-benzene |
| 1,2-Dichloro-4-(trifluoromethoxy)benzene |
| Benzene, 1,2-dichloro-4-(trifluoromethoxy)- |
| 3,4-dichloro-trifluoromethoxybenzene |
| 3,4-Dichlor-trifluormethoxybenzol |
