Introduction：Basic information about CAS 1193385-18-0|5-Bromo-3-fluoro-2-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Bromo-3-fluoro-2-nitroaniline |
|---|
| CAS Number | 1193385-18-0 | Molecular Weight | 235.011 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 345.4±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H4BrFN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 162.7±26.5 °C |
|---|
Names
| Name | 5-bromo-3-fluoro-2-nitro-aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 345.4±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H4BrFN2O2 |
|---|
| Molecular Weight | 235.011 |
|---|
| Flash Point | 162.7±26.5 °C |
|---|
| Exact Mass | 233.944016 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 2.95 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | PTQHTXBNGYMWER-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(Br)cc(F)c1[N+](=O)[O-] |
|---|
Synonyms
| 2-amino-4-bromo-6-fluoro-nitrobenzene |
| Benzenamine, 5-bromo-3-fluoro-2-nitro- |
| 5-bromo-3-fluoro-2-nitro-phenylamine |
| 5-Bromo-3-fluoro-2-nitroaniline |
| 2-Amino-4-bromo-6-fluorotoluene |
| 5-bromo-3-fluoro-2-methyl-phenylamine |
| 5-bromo-3-fluoro-2-nitro-benzenamine |
