Introduction：Basic information about CAS 142314-70-3|Methyl 2-formyl-6-nitrobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 2-formyl-6-nitrobenzoate |
|---|
| CAS Number | 142314-70-3 | Molecular Weight | 209.156 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 344.0±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 166.6±27.1 °C |
|---|
Names
| Name | Methyl 2-formyl-6-nitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 344.0±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7NO5 |
|---|
| Molecular Weight | 209.156 |
|---|
| Flash Point | 166.6±27.1 °C |
|---|
| Exact Mass | 209.032425 |
|---|
| PSA | 89.19000 |
|---|
| LogP | 0.91 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | UFSGWOAUSVQOQB-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1c(C=O)cccc1[N+](=O)[O-] |
|---|
Synonyms
| 2-formyl-6-nitro-benzoic acid methyl ester |
| Benzoic acid, 2-formyl-6-nitro-, methyl ester |
| Benzoic acid,2-formyl-6-nitro-,methyl ester |
| Methyl 2-formyl-6-nitrobenzoate |
| 2-Formyl-6-nitro-benzoesaeure-methylester |
