Introduction:Basic information about CAS 152402-98-7|2-[[(4-Nitro-3-Methyl-2-Pyridinyl)-2-Methyl]Thio]-1H-Benzimidazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[[(4-Nitro-3-Methyl-2-Pyridinyl)-2-Methyl]Thio]-1H-Benzimidazole |
|---|
| CAS Number | 152402-98-7 | Molecular Weight | 300.33600 |
|---|
| Density | 1.448g/cm3 | Boiling Point | 559.345ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12N4O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 292.082ºC |
|---|
Names
| Name | 2-[(3-methyl-4-nitropyridin-2-yl)methylsulfanyl]-1H-benzimidazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.448g/cm3 |
|---|
| Boiling Point | 559.345ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12N4O2S |
|---|
| Molecular Weight | 300.33600 |
|---|
| Flash Point | 292.082ºC |
|---|
| Exact Mass | 300.06800 |
|---|
| PSA | 112.69000 |
|---|
| LogP | 3.99000 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.719 |
|---|
| InChIKey | HLHGTWPLDSUGJJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c([N+](=O)[O-])ccnc1CSc1nc2ccccc2[nH]1 |
|---|
Safety Information
Synonyms
| 2-[[(4-nitro-3-methyl-2-pyridinyl)methyl]thio]-1H-benzimidazole |
| 2-(2-AMINO-PYRIMIDIN-4-YL)-4-BROMO-PHENOL |
| 2-[[3-methyl-4-nitro-2-pyridyl]methylthio]benzimidazole |
| 2-(3-methyl-4-nitro-pyridin-2-ylmethylsulfanyl)-1H-benzoimidazole |
| 1H-Benzimidazole,2-[[(3-methyl-4-nitro-2-pyridinyl)methyl]thio] |
| 2-[(4-nitro-3-methylpyridin-2-yl)methylsulfanyl]-1H-benzoimidazole |
| 2-[(3-Methyl-4-nitro-2-pyridinyl methyl)thio]-1H-benzimidazole |