Introduction：Basic information about CAS 866157-46-2|1-[(5-Nitro-2-pyridinyl)amino]cyclopentanecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[(5-Nitro-2-pyridinyl)amino]cyclopentanecarboxylic acid |
|---|
| CAS Number | 866157-46-2 | Molecular Weight | 251.23900 |
|---|
| Density | 1.483g/cm3 | Boiling Point | 487.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 248.5ºC |
|---|
Names
| Name | 1-[(5-Nitro-2-pyridinyl)amino]cyclopentanecarboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.483g/cm3 |
|---|
| Boiling Point | 487.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13N3O4 |
|---|
| Molecular Weight | 251.23900 |
|---|
| Flash Point | 248.5ºC |
|---|
| Exact Mass | 251.09100 |
|---|
| PSA | 108.04000 |
|---|
| LogP | 2.39530 |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | HZXVKDMYVOMDFF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1(Nc2ccc([N+](=O)[O-])cn2)CCCC1 |
|---|
