Introduction:Basic information about CAS 80428-29-1|Mafoprazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Mafoprazine |
|---|
| CAS Number | 80428-29-1 | Molecular Weight | 401.47400 |
|---|
| Density | 1.192g/cm3 | Boiling Point | 590.5ºC at 760 mmHg |
|---|
| Molecular Formula | C22H28FN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 310.9ºC |
|---|
Names
| Name | N-[4-[3-[4-(2-fluorophenyl)piperazin-1-yl]propoxy]-3-methoxyphenyl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.192g/cm3 |
|---|
| Boiling Point | 590.5ºC at 760 mmHg |
|---|
| Molecular Formula | C22H28FN3O3 |
|---|
| Molecular Weight | 401.47400 |
|---|
| Flash Point | 310.9ºC |
|---|
| Exact Mass | 401.21100 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 4.03620 |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | PHOCQBYGUQPMIB-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(NC(C)=O)ccc1OCCCN1CCN(c2ccccc2F)CC1 |
|---|
Synonyms
| Mafoprazina |
| Mafoprazine |
| Mafoprazinum |