Introduction：Basic information about CAS 5528-53-0|(E)-1-(4,8-dimethoxynaphthalen-1-yl)-N-(1-prop-2-enylbenzimidazol-2-yl)methanimine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (E)-1-(4,8-dimethoxynaphthalen-1-yl)-N-(1-prop-2-enylbenzimidazol-2-yl)methanimine |
|---|
| CAS Number | 5528-53-0 | Molecular Weight | 371.43200 |
|---|
| Density | 1.16g/cm3 | Boiling Point | 580.4ºC at 760mmHg |
|---|
| Molecular Formula | C23H21N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 304.8ºC |
|---|
Names
| Name | (E)-1-(4,8-dimethoxynaphthalen-1-yl)-N-(1-prop-2-enylbenzimidazol-2-yl)methanimine |
|---|
Chemical & Physical Properties
| Density | 1.16g/cm3 |
|---|
| Boiling Point | 580.4ºC at 760mmHg |
|---|
| Molecular Formula | C23H21N3O2 |
|---|
| Molecular Weight | 371.43200 |
|---|
| Flash Point | 304.8ºC |
|---|
| Exact Mass | 371.16300 |
|---|
| PSA | 48.64000 |
|---|
| LogP | 5.14330 |
|---|
| Index of Refraction | 1.61 |
|---|
| InChIKey | DZWXSULKUSUDIJ-BUVRLJJBSA-N |
|---|
| SMILES | C=CCn1c(N=Cc2ccc(OC)c3cccc(OC)c23)nc2ccccc21 |
|---|
