Introduction:Basic information about CAS 21767-36-2|3-(3-Trifluoromethylphenyl)pyrrolidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(3-Trifluoromethylphenyl)pyrrolidine |
|---|
| CAS Number | 21767-36-2 | Molecular Weight | 215.21500 |
|---|
| Density | 1.179g/cm3 | Boiling Point | 239.9ºC at 760mmHg |
|---|
| Molecular Formula | C11H12F3N | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-[3-(Trifluoromethyl)phenyl]pyrrolidine |
|---|
Chemical & Physical Properties
| Density | 1.179g/cm3 |
|---|
| Boiling Point | 239.9ºC at 760mmHg |
|---|
| Molecular Formula | C11H12F3N |
|---|
| Molecular Weight | 215.21500 |
|---|
| Exact Mass | 215.09200 |
|---|
| PSA | 12.03000 |
|---|
| LogP | 3.11110 |
|---|
| Vapour Pressure | 0.039mmHg at 25°C |
|---|
| Index of Refraction | 1.473 |
|---|
| InChIKey | CEYJDGCARZGVDZ-UHFFFAOYSA-N |
|---|
| SMILES | Cl.FC(F)(F)c1cccc(C2CCNC2)c1 |
|---|